About N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide
N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide (PubChem CID 172887668) has the molecular formula C15H18F2N2O3S
and a molecular weight of 344.38 g/mol. Its IUPAC name is N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide |
| PubChem CID | 172887668 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide |
| SMILES | C=CC(=O)N1CCC(F)(F)[C@H](NS(=O)(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H18F2N2O3S/c1-2-14(20)19-9-8-15(16,17)13(10-19)18-23(21,22)11-12-6-4-3-5-7-12/h2-7,13,18H,1,8-11H2/t13-/m1/s1 |
| InChIKey | XPKFBBTTZQLDHM-CYBMUJFWSA-N |
| XLogP | 1.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide?
The IUPAC name of N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide (CID 172887668) is N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide.
What is the SMILES notation for N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide?
The canonical SMILES for N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide is C=CC(=O)N1CCC(F)(F)[C@H](NS(=O)(=O)Cc2ccccc2)C1.
What is the InChIKey of N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide?
The InChIKey is XPKFBBTTZQLDHM-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H18F2N2O3S/c1-2-14(20)19-9-8-15(16,17)13(10-19)18-23(21,22)11-12-6-4-3-5-7-12/h2-7,13,18H,1,8-11H2/t13-/m1/s1.
What are the key properties of N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide?
N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide has a molecular weight of 344.38 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-1-phenylmethanesulfonamide is sourced from PubChem (CID 172887668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).