C13H16F2N4O2 — CID 172894726
1-[(3R)-4,4-difluoro-3-[(6-methoxypyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 172894726) has the molecular formula C13H16F2N4O2 and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-[(3R)-4,4-difluoro-3-[(6-methoxypyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-4,4-difluoro-3-[(6-methoxypyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172894726 |
| Molecular Formula | C13H16F2N4O2 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-[(3R)-4,4-difluoro-3-[(6-methoxypyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(F)(F)[C@H](Nc2cc(OC)ncn2)C1 |
| InChI | InChI=1S/C13H16F2N4O2/c1-3-12(20)19-5-4-13(14,15)9(7-19)18-10-6-11(21-2)17-8-16-10/h3,6,8-9H,1,4-5,7H2,2H3,(H,16,17,18)/t9-/m1/s1 |
| InChIKey | SYCZURKALXPALJ-SECBINFHSA-N |
| XLogP | 1.32 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|