C19H25F2N3O2 — CID 172887719
1-(2-tert-butylphenyl)-3-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]urea (PubChem CID 172887719) has the molecular formula C19H25F2N3O2 and a molecular weight of 365.42 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-3-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]urea.
| Compound Name | 1-(2-tert-butylphenyl)-3-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]urea |
|---|---|
| PubChem CID | 172887719 |
| Molecular Formula | C19H25F2N3O2 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-(2-tert-butylphenyl)-3-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]urea |
| SMILES | C=CC(=O)N1CCC(F)(F)[C@H](NC(=O)Nc2ccccc2C(C)(C)C)C1 |
| InChI | InChI=1S/C19H25F2N3O2/c1-5-16(25)24-11-10-19(20,21)15(12-24)23-17(26)22-14-9-7-6-8-13(14)18(2,3)4/h5-9,15H,1,10-12H2,2-4H3,(H2,22,23,26)/t15-/m1/s1 |
| InChIKey | HACAHOJFVWMULO-OAHLLOKOSA-N |
| XLogP | 3.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|