C18H23ClN4O2 — CID 172889217
1-[(2S,5S)-2-[4-(3-chloro-2-pyridinyl)piperazine-1-carbonyl]-5-methylpyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 172889217) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 1-[(2S,5S)-2-[4-(3-chloro-2-pyridinyl)piperazine-1-carbonyl]-5-methylpyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,5S)-2-[4-(3-chloro-2-pyridinyl)piperazine-1-carbonyl]-5-methylpyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172889217 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-[(2S,5S)-2-[4-(3-chloro-2-pyridinyl)piperazine-1-carbonyl]-5-methylpyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1[C@@H](C)CC[C@H]1C(=O)N1CCN(c2ncccc2Cl)CC1 |
| InChI | InChI=1S/C18H23ClN4O2/c1-3-16(24)23-13(2)6-7-15(23)18(25)22-11-9-21(10-12-22)17-14(19)5-4-8-20-17/h3-5,8,13,15H,1,6-7,9-12H2,2H3/t13-,15-/m0/s1 |
| InChIKey | CBURMPZCMXWXQK-ZFWWWQNUSA-N |
| XLogP | 1.95 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|