C20H24N4O2 — CID 172895585
N-(3-hydroxypropyl)-4-[2-(1H-indazol-4-ylmethylamino)ethyl]benzamide (PubChem CID 172895585) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-4-[2-(1H-indazol-4-ylmethylamino)ethyl]benzamide.
| Compound Name | N-(3-hydroxypropyl)-4-[2-(1H-indazol-4-ylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 172895585 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-(3-hydroxypropyl)-4-[2-(1H-indazol-4-ylmethylamino)ethyl]benzamide |
| SMILES | O=C(NCCCO)c1ccc(CCNCc2cccc3[nH]ncc23)cc1 |
| InChI | InChI=1S/C20H24N4O2/c25-12-2-10-22-20(26)16-7-5-15(6-8-16)9-11-21-13-17-3-1-4-19-18(17)14-23-24-19/h1,3-8,14,21,25H,2,9-13H2,(H,22,26)(H,23,24) |
| InChIKey | BYIKQEHTQYCAKV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|