C20H28Cl2N2O2 — CID 172896985
4-(2,7-diazaspiro[4.5]decan-7-ylmethyl)-6,8-dimethylchromen-2-one;dihydrochloride (PubChem CID 172896985) has the molecular formula C20H28Cl2N2O2 and a molecular weight of 399.36 g/mol. Its IUPAC name is 4-(2,7-diazaspiro[4.5]decan-7-ylmethyl)-6,8-dimethylchromen-2-one;dihydrochloride.
| Compound Name | 4-(2,7-diazaspiro[4.5]decan-7-ylmethyl)-6,8-dimethylchromen-2-one;dihydrochloride |
|---|---|
| PubChem CID | 172896985 |
| Molecular Formula | C20H28Cl2N2O2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-(2,7-diazaspiro[4.5]decan-7-ylmethyl)-6,8-dimethylchromen-2-one;dihydrochloride |
| SMILES | Cc1cc(C)c2oc(=O)cc(CN3CCCC4(CCNC4)C3)c2c1.Cl.Cl |
| InChI | InChI=1S/C20H26N2O2.2ClH/c1-14-8-15(2)19-17(9-14)16(10-18(23)24-19)11-22-7-3-4-20(13-22)5-6-21-12-20;;/h8-10,21H,3-7,11-13H2,1-2H3;2*1H |
| InChIKey | JTPWAVTTWQIFLN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|