C15H17F5N2 — CID 56752325
7-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,7-diazaspiro[4.5]decane (PubChem CID 56752325) has the molecular formula C15H17F5N2 and a molecular weight of 320.31 g/mol. Its IUPAC name is 7-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,7-diazaspiro[4.5]decane.
| Compound Name | 7-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 56752325 |
| Molecular Formula | C15H17F5N2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 7-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,7-diazaspiro[4.5]decane |
| SMILES | Fc1c(F)c(F)c(CN2CCCC3(CCNC3)C2)c(F)c1F |
| InChI | InChI=1S/C15H17F5N2/c16-10-9(11(17)13(19)14(20)12(10)18)6-22-5-1-2-15(8-22)3-4-21-7-15/h21H,1-8H2 |
| InChIKey | YURKBMGWFGKUCS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|