C23H24N4O6 — CID 172897322
N-(1,3-benzodioxol-5-yl)-4-methyl-3-[3-(2-methylimidazol-1-yl)propanoylamino]benzamide;formic acid (PubChem CID 172897322) has the molecular formula C23H24N4O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-methyl-3-[3-(2-methylimidazol-1-yl)propanoylamino]benzamide;formic acid.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-methyl-3-[3-(2-methylimidazol-1-yl)propanoylamino]benzamide;formic acid |
|---|---|
| PubChem CID | 172897322 |
| Molecular Formula | C23H24N4O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-methyl-3-[3-(2-methylimidazol-1-yl)propanoylamino]benzamide;formic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc3c(c2)OCO3)cc1NC(=O)CCn1ccnc1C.O=CO |
| InChI | InChI=1S/C22H22N4O4.CH2O2/c1-14-3-4-16(22(28)24-17-5-6-19-20(12-17)30-13-29-19)11-18(14)25-21(27)7-9-26-10-8-23-15(26)2;2-1-3/h3-6,8,10-12H,7,9,13H2,1-2H3,(H,24,28)(H,25,27);1H,(H,2,3) |
| InChIKey | DDOYHEKZQMNDOS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|