C16H10FNO5S — CID 172904938
methyl 2-[(6-fluoro-1-oxoisochromene-3-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 172904938) has the molecular formula C16H10FNO5S and a molecular weight of 347.32 g/mol. Its IUPAC name is methyl 2-[(6-fluoro-1-oxoisochromene-3-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(6-fluoro-1-oxoisochromene-3-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 172904938 |
| Molecular Formula | C16H10FNO5S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | methyl 2-[(6-fluoro-1-oxoisochromene-3-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)c1cc2cc(F)ccc2c(=O)o1 |
| InChI | InChI=1S/C16H10FNO5S/c1-22-15(20)11-4-5-24-14(11)18-13(19)12-7-8-6-9(17)2-3-10(8)16(21)23-12/h2-7H,1H3,(H,18,19) |
| InChIKey | YQABACOGOOAAIC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |