C17H11ClFNO4 — CID 172905498
N-(3-chloro-4-methoxyphenyl)-6-fluoro-1-oxoisochromene-3-carboxamide (PubChem CID 172905498) has the molecular formula C17H11ClFNO4 and a molecular weight of 347.73 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-6-fluoro-1-oxoisochromene-3-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-6-fluoro-1-oxoisochromene-3-carboxamide |
|---|---|
| PubChem CID | 172905498 |
| Molecular Formula | C17H11ClFNO4 |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-6-fluoro-1-oxoisochromene-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3cc(F)ccc3c(=O)o2)cc1Cl |
| InChI | InChI=1S/C17H11ClFNO4/c1-23-14-5-3-11(8-13(14)18)20-16(21)15-7-9-6-10(19)2-4-12(9)17(22)24-15/h2-8H,1H3,(H,20,21) |
| InChIKey | QBIKUOZRBCKPPP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |