C17H11BrClNO4 — CID 35180956
7-bromo-N-(3-chloro-4-methoxyphenyl)-4-oxochromene-2-carboxamide (PubChem CID 35180956) has the molecular formula C17H11BrClNO4 and a molecular weight of 408.64 g/mol. Its IUPAC name is 7-bromo-N-(3-chloro-4-methoxyphenyl)-4-oxochromene-2-carboxamide.
| Compound Name | 7-bromo-N-(3-chloro-4-methoxyphenyl)-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 35180956 |
| Molecular Formula | C17H11BrClNO4 |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 7-bromo-N-(3-chloro-4-methoxyphenyl)-4-oxochromene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(=O)c3ccc(Br)cc3o2)cc1Cl |
| InChI | InChI=1S/C17H11BrClNO4/c1-23-14-5-3-10(7-12(14)19)20-17(22)16-8-13(21)11-4-2-9(18)6-15(11)24-16/h2-8H,1H3,(H,20,22) |
| InChIKey | ROPMDTAKYZQURE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |