C14H23F3N2O2 — CID 172907277
N-cyclohexyl-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 172907277) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-cyclohexyl-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | N-cyclohexyl-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 172907277 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-cyclohexyl-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CC(C)(C)C(NC(=O)C(F)(F)F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H23F3N2O2/c1-13(2,3)10(19-12(21)14(15,16)17)11(20)18-9-7-5-4-6-8-9/h9-10H,4-8H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | KXTNZWXDMBDBMM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |