C25H32N2O4 — CID 172907733
tert-butyl N-[3-[(3aR,8bR)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-yl]-4-butoxyphenyl]carbamate (PubChem CID 172907733) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is tert-butyl N-[3-[(3aR,8bR)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-yl]-4-butoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3aR,8bR)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-yl]-4-butoxyphenyl]carbamate |
|---|---|
| PubChem CID | 172907733 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | tert-butyl N-[3-[(3aR,8bR)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-yl]-4-butoxyphenyl]carbamate |
| SMILES | CCCCOc1ccc(NC(=O)OC(C)(C)C)cc1[C@]12CCO[C@H]1Nc1ccccc12 |
| InChI | InChI=1S/C25H32N2O4/c1-5-6-14-29-21-12-11-17(26-23(28)31-24(2,3)4)16-19(21)25-13-15-30-22(25)27-20-10-8-7-9-18(20)25/h7-12,16,22,27H,5-6,13-15H2,1-4H3,(H,26,28)/t22-,25-/m1/s1 |
| InChIKey | BFBLYTKUAHFDDJ-RCZVLFRGSA-N |
| XLogP | 5.67 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|