C21H35N5O4 — CID 172912785
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-pyrazol-1-ylbutan-1-one;formic acid (PubChem CID 172912785) has the molecular formula C21H35N5O4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-pyrazol-1-ylbutan-1-one;formic acid.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-pyrazol-1-ylbutan-1-one;formic acid |
|---|---|
| PubChem CID | 172912785 |
| Molecular Formula | C21H35N5O4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-pyrazol-1-ylbutan-1-one;formic acid |
| SMILES | CN1CCN([C@@H]2C[C@@H]3CN(C(=O)CCCn4cccn4)C[C@@H]3C[C@H]2O)CC1.O=CO |
| InChI | InChI=1S/C20H33N5O2.CH2O2/c1-22-8-10-23(11-9-22)18-12-16-14-24(15-17(16)13-19(18)26)20(27)4-2-6-25-7-3-5-21-25;2-1-3/h3,5,7,16-19,26H,2,4,6,8-15H2,1H3;1H,(H,2,3)/t16-,17+,18-,19-;/m1./s1 |
| InChIKey | VUUVNDGWECFLSW-MPIUBBFZSA-N |
| XLogP | 0.21 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|