C27H26N2O8 — CID 172916578
(2S)-2-[[(2Z)-2-(1,3-benzodioxol-5-yl)-2-methoxyiminoacetyl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid (PubChem CID 172916578) has the molecular formula C27H26N2O8 and a molecular weight of 506.51 g/mol. Its IUPAC name is (2S)-2-[[(2Z)-2-(1,3-benzodioxol-5-yl)-2-methoxyiminoacetyl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2Z)-2-(1,3-benzodioxol-5-yl)-2-methoxyiminoacetyl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 172916578 |
| Molecular Formula | C27H26N2O8 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | (2S)-2-[[(2Z)-2-(1,3-benzodioxol-5-yl)-2-methoxyiminoacetyl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H](Cc1ccc(-c2c(OC)cccc2OC)cc1)C(=O)O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H26N2O8/c1-33-21-5-4-6-22(34-2)24(21)17-9-7-16(8-10-17)13-19(27(31)32)28-26(30)25(29-35-3)18-11-12-20-23(14-18)37-15-36-20/h4-12,14,19H,13,15H2,1-3H3,(H,28,30)(H,31,32)/b29-25-/t19-/m0/s1 |
| InChIKey | LBYJQBUFLRCYBF-WIHWPTRJSA-N |
| XLogP | 3.26 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|