C28H36N2O6S — CID 143079617
(2S)-2-[[(2Z)-2-cyclohexyl-2-methoxyiminoacetyl]amino]-3-[4-[2,6-dimethoxy-4-(methylsulfanylmethyl)phenyl]phenyl]propanoic acid (PubChem CID 143079617) has the molecular formula C28H36N2O6S and a molecular weight of 528.67 g/mol. Its IUPAC name is (2S)-2-[[(2Z)-2-cyclohexyl-2-methoxyiminoacetyl]amino]-3-[4-[2,6-dimethoxy-4-(methylsulfanylmethyl)phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2Z)-2-cyclohexyl-2-methoxyiminoacetyl]amino]-3-[4-[2,6-dimethoxy-4-(methylsulfanylmethyl)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143079617 |
| Molecular Formula | C28H36N2O6S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (2S)-2-[[(2Z)-2-cyclohexyl-2-methoxyiminoacetyl]amino]-3-[4-[2,6-dimethoxy-4-(methylsulfanylmethyl)phenyl]phenyl]propanoic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H](Cc1ccc(-c2c(OC)cc(CSC)cc2OC)cc1)C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C28H36N2O6S/c1-34-23-15-19(17-37-4)16-24(35-2)25(23)20-12-10-18(11-13-20)14-22(28(32)33)29-27(31)26(30-36-3)21-8-6-5-7-9-21/h10-13,15-16,21-22H,5-9,14,17H2,1-4H3,(H,29,31)(H,32,33)/b30-26-/t22-/m0/s1 |
| InChIKey | WXMHAFNAYSFWAD-LVQIJYKZSA-N |
| XLogP | 4.93 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|