C24H27FN8 — CID 172921090
4-N-[(3Z,5E)-6-fluoro-2-methylidenehexa-3,5-dienyl]-2-N-[(E)-1H-indol-3-ylmethylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 172921090) has the molecular formula C24H27FN8 and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-N-[(3Z,5E)-6-fluoro-2-methylidenehexa-3,5-dienyl]-2-N-[(E)-1H-indol-3-ylmethylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(3Z,5E)-6-fluoro-2-methylidenehexa-3,5-dienyl]-2-N-[(E)-1H-indol-3-ylmethylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 172921090 |
| Molecular Formula | C24H27FN8 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4-N-[(3Z,5E)-6-fluoro-2-methylidenehexa-3,5-dienyl]-2-N-[(E)-1H-indol-3-ylmethylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | C=C(/C=C\C=C\F)CNc1nc(N/N=C/c2c[nH]c3ccccc23)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C24H27FN8/c1-18(9-5-6-12-25)15-27-22-29-23(31-24(30-22)33-13-7-2-8-14-33)32-28-17-19-16-26-21-11-4-3-10-20(19)21/h3-6,9-12,16-17,26H,1-2,7-8,13-15H2,(H2,27,29,30,31,32)/b9-5-,12-6+,28-17+ |
| InChIKey | KVTKGSWTXGTVRX-GUJZBHBASA-N |
| XLogP | 4.80 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|