C26H31ClN6O3 — CID 172922354
[(Z)-[amino-(3-phenyl-3-azabicyclo[3.1.0]hexan-6-yl)methylidene]amino] 2-chloroacetate;N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide (PubChem CID 172922354) has the molecular formula C26H31ClN6O3 and a molecular weight of 511.03 g/mol. Its IUPAC name is [(Z)-[amino-(3-phenyl-3-azabicyclo[3.1.0]hexan-6-yl)methylidene]amino] 2-chloroacetate;N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide.
| Compound Name | [(Z)-[amino-(3-phenyl-3-azabicyclo[3.1.0]hexan-6-yl)methylidene]amino] 2-chloroacetate;N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide |
|---|---|
| PubChem CID | 172922354 |
| Molecular Formula | C26H31ClN6O3 |
| Molecular Weight | 511.03 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | [(Z)-[amino-(3-phenyl-3-azabicyclo[3.1.0]hexan-6-yl)methylidene]amino] 2-chloroacetate;N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide |
| SMILES | N/C(=N\O)C1C2CN(c3ccccc3)CC21.N/C(=N\OC(=O)CCl)C1C2CN(c3ccccc3)CC21 |
| InChI | InChI=1S/C14H16ClN3O2.C12H15N3O/c15-6-12(19)20-17-14(16)13-10-7-18(8-11(10)13)9-4-2-1-3-5-9;13-12(14-16)11-9-6-15(7-10(9)11)8-4-2-1-3-5-8/h1-5,10-11,13H,6-8H2,(H2,16,17);1-5,9-11,16H,6-7H2,(H2,13,14) |
| InChIKey | QYMOLBWRIYDNBA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.03 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|