About (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide
(1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide (PubChem CID 153307095) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide.
Molecular Properties
| Compound Name | (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide |
| PubChem CID | 153307095 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide |
| SMILES | N/C(=N\O)C1[C@H]2CN(c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C12H15N3O/c13-12(14-16)11-9-6-15(7-10(9)11)8-4-2-1-3-5-8/h1-5,9-11,16H,6-7H2,(H2,13,14)/t9-,10+,11? |
| InChIKey | VWUSMBIDJRJTRM-ZACCUICWSA-N |
| XLogP | 1.12 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide?
The IUPAC name of (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide (CID 153307095) is (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide.
What is the SMILES notation for (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide?
The canonical SMILES for (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide is N/C(=N\O)C1[C@H]2CN(c3ccccc3)C[C@@H]12.
What is the InChIKey of (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide?
The InChIKey is VWUSMBIDJRJTRM-ZACCUICWSA-N. The full InChI is InChI=1S/C12H15N3O/c13-12(14-16)11-9-6-15(7-10(9)11)8-4-2-1-3-5-8/h1-5,9-11,16H,6-7H2,(H2,13,14)/t9-,10+,11?.
What are the key properties of (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide?
(1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide has a molecular weight of 217.27 g/mol, XLogP of 1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-N'-hydroxy-3-phenyl-3-azabicyclo[3.1.0]hexane-6-carboximidamide is sourced from PubChem (CID 153307095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).