C18H12Cl2N2O2 — CID 172922426
(3E)-5,6-dichloro-3-[(3Z)-3-methoxyimino-1H-inden-2-ylidene]-1H-indol-2-one (PubChem CID 172922426) has the molecular formula C18H12Cl2N2O2 and a molecular weight of 359.21 g/mol. Its IUPAC name is (3E)-5,6-dichloro-3-[(3Z)-3-methoxyimino-1H-inden-2-ylidene]-1H-indol-2-one.
| Compound Name | (3E)-5,6-dichloro-3-[(3Z)-3-methoxyimino-1H-inden-2-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 172922426 |
| Molecular Formula | C18H12Cl2N2O2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | (3E)-5,6-dichloro-3-[(3Z)-3-methoxyimino-1H-inden-2-ylidene]-1H-indol-2-one |
| SMILES | CO/N=C1C(=C2/C(=O)Nc3cc(Cl)c(Cl)cc32)/Cc2ccccc2/1 |
| InChI | InChI=1S/C18H12Cl2N2O2/c1-24-22-17-10-5-3-2-4-9(10)6-12(17)16-11-7-13(19)14(20)8-15(11)21-18(16)23/h2-5,7-8H,6H2,1H3,(H,21,23)/b16-12+,22-17+ |
| InChIKey | QIJZLZIPMFRRBP-KOQHRSNOSA-N |
| XLogP | 4.31 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|