C29H37F3N2O — CID 172927469
(E)-1-[4-(azetidin-1-ylmethyl)-3-ethylphenyl]-N-[[4-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexyl)-3-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 172927469) has the molecular formula C29H37F3N2O and a molecular weight of 496.68 g/mol. Its IUPAC name is (E)-1-[4-(azetidin-1-ylmethyl)-3-ethylphenyl]-N-[[4-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexyl)-3-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | (E)-1-[4-(azetidin-1-ylmethyl)-3-ethylphenyl]-N-[[4-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexyl)-3-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 172927469 |
| Molecular Formula | C29H37F3N2O |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.35 |
| IUPAC Name | (E)-1-[4-(azetidin-1-ylmethyl)-3-ethylphenyl]-N-[[4-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexyl)-3-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])(c2ccc(CO/N=C(\C)c3ccc(CN4CCC4)c(CC)c3)cc2C(F)(F)F)C([2H])([2H])C([2H])([2H])C1([2H])C |
| InChI | InChI=1S/C29H37F3N2O/c1-4-23-17-25(11-12-26(23)18-34-14-5-15-34)21(3)33-35-19-22-8-13-27(28(16-22)29(30,31)32)24-9-6-20(2)7-10-24/h8,11-13,16-17,20,24H,4-7,9-10,14-15,18-19H2,1-3H3/b33-21+/i6D2,7D2,9D2,10D2,20D,24D |
| InChIKey | UTSLBFPMKMMZLC-QTGSHAHVSA-N |
| XLogP | 7.71 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|