C24H27N5O2 — CID 172931382
1-methyl-4-[3-methyl-2-[[(Z)-1-[(1S,3R,12R)-9-tricyclo[5.4.1.03,12]dodeca-5,7,9-trienyl]ethylideneamino]oxymethyl]phenyl]tetrazol-5-one (PubChem CID 172931382) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[[(Z)-1-[(1S,3R,12R)-9-tricyclo[5.4.1.03,12]dodeca-5,7,9-trienyl]ethylideneamino]oxymethyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[[(Z)-1-[(1S,3R,12R)-9-tricyclo[5.4.1.03,12]dodeca-5,7,9-trienyl]ethylideneamino]oxymethyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 172931382 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[[(Z)-1-[(1S,3R,12R)-9-tricyclo[5.4.1.03,12]dodeca-5,7,9-trienyl]ethylideneamino]oxymethyl]phenyl]tetrazol-5-one |
| SMILES | C/C(=N/OCc1c(C)cccc1-n1nnn(C)c1=O)C1=CC[C@@H]2C[C@H]3CC=CC(=C1)[C@H]32 |
| InChI | InChI=1S/C24H27N5O2/c1-15-6-4-9-22(29-24(30)28(3)26-27-29)21(15)14-31-25-16(2)17-10-11-20-13-19-8-5-7-18(12-17)23(19)20/h4-7,9-10,12,19-20,23H,8,11,13-14H2,1-3H3/b25-16-/t19-,20-,23-/m1/s1 |
| InChIKey | ASWMMSIZLWJCEW-ZDLDLWFXSA-N |
| XLogP | 3.64 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|