C17H23Cl2N2O2PS — CID 172946769
N-dichlorophosphinothioyl-N-[(E)-[4-(phenoxymethoxy)phenyl]methylideneamino]methanamine;methane (PubChem CID 172946769) has the molecular formula C17H23Cl2N2O2PS and a molecular weight of 421.33 g/mol. Its IUPAC name is N-dichlorophosphinothioyl-N-[(E)-[4-(phenoxymethoxy)phenyl]methylideneamino]methanamine;methane.
| Compound Name | N-dichlorophosphinothioyl-N-[(E)-[4-(phenoxymethoxy)phenyl]methylideneamino]methanamine;methane |
|---|---|
| PubChem CID | 172946769 |
| Molecular Formula | C17H23Cl2N2O2PS |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-dichlorophosphinothioyl-N-[(E)-[4-(phenoxymethoxy)phenyl]methylideneamino]methanamine;methane |
| SMILES | C.C.CN(/N=C/c1ccc(OCOc2ccccc2)cc1)P(=S)(Cl)Cl |
| InChI | InChI=1S/C15H15Cl2N2O2PS.2CH4/c1-19(22(16,17)23)18-11-13-7-9-15(10-8-13)21-12-20-14-5-3-2-4-6-14;;/h2-11H,12H2,1H3;2*1H4/b18-11+;; |
| InChIKey | NWEYQXLWOMIRLI-UMVVUDSKSA-N |
| XLogP | 6.34 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|