C23H27N3P2S — CID 89017166
N-[[4-[dimethylphosphinothioylimino(diphenyl)-λ5-phosphanyl]phenyl]methylideneamino]-N-methylmethanamine (PubChem CID 89017166) has the molecular formula C23H27N3P2S and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[[4-[dimethylphosphinothioylimino(diphenyl)-λ5-phosphanyl]phenyl]methylideneamino]-N-methylmethanamine.
| Compound Name | N-[[4-[dimethylphosphinothioylimino(diphenyl)-λ5-phosphanyl]phenyl]methylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 89017166 |
| Molecular Formula | C23H27N3P2S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[[4-[dimethylphosphinothioylimino(diphenyl)-λ5-phosphanyl]phenyl]methylideneamino]-N-methylmethanamine |
| SMILES | CN(C)N=Cc1ccc(P(=NP(C)(C)=S)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N3P2S/c1-26(2)24-19-20-15-17-23(18-16-20)28(25-27(3,4)29,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-19H,1-4H3 |
| InChIKey | OXGBCRYZVPFWKS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|