C28H27Cl3N2O7 — CID 172947608
(1Z)-2-chloro-N-hydroxybenzenecarboximidoyl chloride;methyl 3-(2-chlorophenyl)-5-cyclopropyl-1,2-oxazole-4-carboxylate;methyl 3-cyclopropyl-3-oxopropanoate (PubChem CID 172947608) has the molecular formula C28H27Cl3N2O7 and a molecular weight of 609.89 g/mol. Its IUPAC name is (1Z)-2-chloro-N-hydroxybenzenecarboximidoyl chloride;methyl 3-(2-chlorophenyl)-5-cyclopropyl-1,2-oxazole-4-carboxylate;methyl 3-cyclopropyl-3-oxopropanoate.
| Compound Name | (1Z)-2-chloro-N-hydroxybenzenecarboximidoyl chloride;methyl 3-(2-chlorophenyl)-5-cyclopropyl-1,2-oxazole-4-carboxylate;methyl 3-cyclopropyl-3-oxopropanoate |
|---|---|
| PubChem CID | 172947608 |
| Molecular Formula | C28H27Cl3N2O7 |
| Molecular Weight | 609.89 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | (1Z)-2-chloro-N-hydroxybenzenecarboximidoyl chloride;methyl 3-(2-chlorophenyl)-5-cyclopropyl-1,2-oxazole-4-carboxylate;methyl 3-cyclopropyl-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)C1CC1.COC(=O)c1c(-c2ccccc2Cl)noc1C1CC1.O/N=C(\Cl)c1ccccc1Cl |
| InChI | InChI=1S/C14H12ClNO3.C7H5Cl2NO.C7H10O3/c1-18-14(17)11-12(9-4-2-3-5-10(9)15)16-19-13(11)8-6-7-8;8-6-4-2-1-3-5(6)7(9)10-11;1-10-7(9)4-6(8)5-2-3-5/h2-5,8H,6-7H2,1H3;1-4,11H;5H,2-4H2,1H3/b;10-7-; |
| InChIKey | RSSALBVNFINZNT-YAJOTRLJSA-N |
| XLogP | 6.90 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.89 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|