C29H26Cl2N2O4 — CID 165004386
3-(2-chlorophenyl)-5-cyclopropyl-4-[(E)-2-methoxyethenyl]-1,2-oxazole;2-[3-(2-chlorophenyl)-5-cyclopropyl-1,2-oxazol-4-yl]acetaldehyde (PubChem CID 165004386) has the molecular formula C29H26Cl2N2O4 and a molecular weight of 537.44 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-cyclopropyl-4-[(E)-2-methoxyethenyl]-1,2-oxazole;2-[3-(2-chlorophenyl)-5-cyclopropyl-1,2-oxazol-4-yl]acetaldehyde.
| Compound Name | 3-(2-chlorophenyl)-5-cyclopropyl-4-[(E)-2-methoxyethenyl]-1,2-oxazole;2-[3-(2-chlorophenyl)-5-cyclopropyl-1,2-oxazol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 165004386 |
| Molecular Formula | C29H26Cl2N2O4 |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 3-(2-chlorophenyl)-5-cyclopropyl-4-[(E)-2-methoxyethenyl]-1,2-oxazole;2-[3-(2-chlorophenyl)-5-cyclopropyl-1,2-oxazol-4-yl]acetaldehyde |
| SMILES | CO/C=C/c1c(-c2ccccc2Cl)noc1C1CC1.O=CCc1c(-c2ccccc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C15H14ClNO2.C14H12ClNO2/c1-18-9-8-12-14(11-4-2-3-5-13(11)16)17-19-15(12)10-6-7-10;15-12-4-2-1-3-10(12)13-11(7-8-17)14(18-16-13)9-5-6-9/h2-5,8-10H,6-7H2,1H3;1-4,8-9H,5-7H2/b9-8+; |
| InChIKey | ISWGXPRWXPPMGY-HRNDJLQDSA-N |
| XLogP | 8.10 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|