C19H19BN4O2S — CID 172961854
2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[(E)-(2-hydroxy-5-methylideneboranylphenyl)methylideneamino]acetamide (PubChem CID 172961854) has the molecular formula C19H19BN4O2S and a molecular weight of 378.27 g/mol. Its IUPAC name is 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[(E)-(2-hydroxy-5-methylideneboranylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[(E)-(2-hydroxy-5-methylideneboranylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 172961854 |
| Molecular Formula | C19H19BN4O2S |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[(E)-(2-hydroxy-5-methylideneboranylphenyl)methylideneamino]acetamide |
| SMILES | C=Bc1ccc(O)c(/C=N/NC(=O)CSc2nc3ccccc3n2CC)c1 |
| InChI | InChI=1S/C19H19BN4O2S/c1-3-24-16-7-5-4-6-15(16)22-19(24)27-12-18(26)23-21-11-13-10-14(20-2)8-9-17(13)25/h4-11,25H,2-3,12H2,1H3,(H,23,26)/b21-11+ |
| InChIKey | SBLCVLHQNOMZQH-SRZZPIQSSA-N |
| XLogP | 1.77 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|