C13H16ArN3O3S- — CID 172964167
argon;1-[(2Z)-2-phenyl-2-(sulfinatohydrazinylidene)acetyl]piperidine (PubChem CID 172964167) has the molecular formula C13H16ArN3O3S- and a molecular weight of 334.30 g/mol. Its IUPAC name is argon;1-[(2Z)-2-phenyl-2-(sulfinatohydrazinylidene)acetyl]piperidine.
| Compound Name | argon;1-[(2Z)-2-phenyl-2-(sulfinatohydrazinylidene)acetyl]piperidine |
|---|---|
| PubChem CID | 172964167 |
| Molecular Formula | C13H16ArN3O3S- |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | argon;1-[(2Z)-2-phenyl-2-(sulfinatohydrazinylidene)acetyl]piperidine |
| SMILES | O=C(/C(=N\NS(=O)[O-])c1ccccc1)N1CCCCC1.[Ar] |
| InChI | InChI=1S/C13H17N3O3S.Ar/c17-13(16-9-5-2-6-10-16)12(14-15-20(18)19)11-7-3-1-4-8-11;/h1,3-4,7-8,15H,2,5-6,9-10H2,(H,18,19);/p-1/b14-12-; |
| InChIKey | NWZRXURNHJTIOH-CTMPBGLUSA-M |
| XLogP | 0.79 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|