C23H30N4O6 — CID 172964919
(2,5-dioxopyrrolidin-1-yl) 4-[[(5Z)-5-(3,3-dimethylbutanoylhydrazinylidene)-7,8-dihydro-6H-quinolin-2-yl]oxy]butanoate (PubChem CID 172964919) has the molecular formula C23H30N4O6 and a molecular weight of 458.52 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[(5Z)-5-(3,3-dimethylbutanoylhydrazinylidene)-7,8-dihydro-6H-quinolin-2-yl]oxy]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[(5Z)-5-(3,3-dimethylbutanoylhydrazinylidene)-7,8-dihydro-6H-quinolin-2-yl]oxy]butanoate |
|---|---|
| PubChem CID | 172964919 |
| Molecular Formula | C23H30N4O6 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[(5Z)-5-(3,3-dimethylbutanoylhydrazinylidene)-7,8-dihydro-6H-quinolin-2-yl]oxy]butanoate |
| SMILES | CC(C)(C)CC(=O)N/N=C1/CCCc2nc(OCCCC(=O)ON3C(=O)CCC3=O)ccc21 |
| InChI | InChI=1S/C23H30N4O6/c1-23(2,3)14-18(28)26-25-17-7-4-6-16-15(17)9-10-19(24-16)32-13-5-8-22(31)33-27-20(29)11-12-21(27)30/h9-10H,4-8,11-14H2,1-3H3,(H,26,28)/b25-17- |
| InChIKey | OOTYKIFJCMSUGO-UQQQWYQISA-N |
| XLogP | 2.44 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|