C20H15FN2O3 — CID 172965199
5-fluoro-1-[2-oxo-2-[4-[(E)-2-phenylethenyl]phenyl]ethyl]pyrimidine-2,4-dione (PubChem CID 172965199) has the molecular formula C20H15FN2O3 and a molecular weight of 350.35 g/mol. Its IUPAC name is 5-fluoro-1-[2-oxo-2-[4-[(E)-2-phenylethenyl]phenyl]ethyl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[2-oxo-2-[4-[(E)-2-phenylethenyl]phenyl]ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172965199 |
| Molecular Formula | C20H15FN2O3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 5-fluoro-1-[2-oxo-2-[4-[(E)-2-phenylethenyl]phenyl]ethyl]pyrimidine-2,4-dione |
| SMILES | O=C(Cn1cc(F)c(=O)[nH]c1=O)c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15FN2O3/c21-17-12-23(20(26)22-19(17)25)13-18(24)16-10-8-15(9-11-16)7-6-14-4-2-1-3-5-14/h1-12H,13H2,(H,22,25,26)/b7-6+ |
| InChIKey | AUBYVVRDNFCMMP-VOTSOKGWSA-N |
| XLogP | 2.73 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|