C17H22N4O5 — CID 172967802
tert-butyl 4-(6-nitro-2-oxo-4H-benzimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 172967802) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is tert-butyl 4-(6-nitro-2-oxo-4H-benzimidazol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-nitro-2-oxo-4H-benzimidazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172967802 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | tert-butyl 4-(6-nitro-2-oxo-4H-benzimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2C(=O)N=C3CC=C([N+](=O)[O-])C=C32)CC1 |
| InChI | InChI=1S/C17H22N4O5/c1-17(2,3)26-16(23)19-8-6-11(7-9-19)20-14-10-12(21(24)25)4-5-13(14)18-15(20)22/h4,10-11H,5-9H2,1-3H3 |
| InChIKey | ADANWQDLDUTTES-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|