C21H22N2O7 — CID 172970004
[(2S,3R)-2-benzyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 172970004) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is [(2S,3R)-2-benzyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(2S,3R)-2-benzyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 172970004 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [(2S,3R)-2-benzyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)[C@@H](Cc1ccccc1)[C@H]1OCCCN1C2=O |
| InChI | InChI=1S/C21H22N2O7/c1-27-21(26)30-13-29-18-16(24)8-10-22-15(12-14-6-3-2-4-7-14)20-23(9-5-11-28-20)19(25)17(18)22/h2-4,6-8,10,15,20H,5,9,11-13H2,1H3/t15-,20+/m0/s1 |
| InChIKey | NLOSTDRXAXIQQJ-MGPUTAFESA-N |
| XLogP | 1.95 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|