C30H51NO2 — CID 172971114
(NE)-N-[[(2R)-2,6,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-5-yl]methylidene]hydroxylamine (PubChem CID 172971114) has the molecular formula C30H51NO2 and a molecular weight of 457.74 g/mol. Its IUPAC name is (NE)-N-[[(2R)-2,6,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-5-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[(2R)-2,6,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-5-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 172971114 |
| Molecular Formula | C30H51NO2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 457.39 |
| IUPAC Name | (NE)-N-[[(2R)-2,6,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-5-yl]methylidene]hydroxylamine |
| SMILES | Cc1c(C)c(/C=N/O)c2c(c1C)O[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C30H51NO2/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-18-30(8)19-17-27-28(20-31-32)25(6)24(5)26(7)29(27)33-30/h20-23,32H,9-19H2,1-8H3/b31-20+/t22-,23-,30-/m1/s1 |
| InChIKey | VPHCZSGFAJXWKA-WRHRFIOSSA-N |
| XLogP | 8.94 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|