C21H17Cl2F3IN3O3 — CID 172975600
4-[5-(3,5-dichlorophenyl)-5-(2,2,2-trifluoroethyl)-4H-1,2-oxazol-3-yl]-N-[(E)-ethoxyiminomethyl]-2-iodobenzamide (PubChem CID 172975600) has the molecular formula C21H17Cl2F3IN3O3 and a molecular weight of 614.19 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(2,2,2-trifluoroethyl)-4H-1,2-oxazol-3-yl]-N-[(E)-ethoxyiminomethyl]-2-iodobenzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(2,2,2-trifluoroethyl)-4H-1,2-oxazol-3-yl]-N-[(E)-ethoxyiminomethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 172975600 |
| Molecular Formula | C21H17Cl2F3IN3O3 |
| Molecular Weight | 614.19 g/mol |
| Exact Mass | 612.96 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(2,2,2-trifluoroethyl)-4H-1,2-oxazol-3-yl]-N-[(E)-ethoxyiminomethyl]-2-iodobenzamide |
| SMILES | CCO/N=C/NC(=O)c1ccc(C2=NOC(CC(F)(F)F)(c3cc(Cl)cc(Cl)c3)C2)cc1I |
| InChI | InChI=1S/C21H17Cl2F3IN3O3/c1-2-32-29-11-28-19(31)16-4-3-12(5-17(16)27)18-9-20(33-30-18,10-21(24,25)26)13-6-14(22)8-15(23)7-13/h3-8,11H,2,9-10H2,1H3,(H,28,29,31) |
| InChIKey | FLRDNRZHNZFVCT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.19 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|