C14H14ClN5O — CID 172976278
(1Z)-2-amino-N-[(7-chloro-2-ethyl-3-methyl-1-benzofuran-5-yl)amino]-2-iminoethanimidoyl cyanide (PubChem CID 172976278) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is (1Z)-2-amino-N-[(7-chloro-2-ethyl-3-methyl-1-benzofuran-5-yl)amino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[(7-chloro-2-ethyl-3-methyl-1-benzofuran-5-yl)amino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976278 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (1Z)-2-amino-N-[(7-chloro-2-ethyl-3-methyl-1-benzofuran-5-yl)amino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(Cl)c2oc(CC)c(C)c2c1 |
| InChI | InChI=1S/C14H14ClN5O/c1-3-12-7(2)9-4-8(5-10(15)13(9)21-12)19-20-11(6-16)14(17)18/h4-5,19H,3H2,1-2H3,(H3,17,18)/b20-11+ |
| InChIKey | CJCSPQCBWTUYEY-RGVLZGJSSA-N |
| XLogP | 3.18 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|