C14H19N7O — CID 172977196
(1Z)-2-amino-N-[2-[[2-(dimethylamino)acetyl]amino]-5-methylanilino]-2-iminoethanimidoyl cyanide (PubChem CID 172977196) has the molecular formula C14H19N7O and a molecular weight of 301.35 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2-[[2-(dimethylamino)acetyl]amino]-5-methylanilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2-[[2-(dimethylamino)acetyl]amino]-5-methylanilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977196 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (1Z)-2-amino-N-[2-[[2-(dimethylamino)acetyl]amino]-5-methylanilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(C)ccc1NC(=O)CN(C)C |
| InChI | InChI=1S/C14H19N7O/c1-9-4-5-10(18-13(22)8-21(2)3)11(6-9)19-20-12(7-15)14(16)17/h4-6,19H,8H2,1-3H3,(H3,16,17)(H,18,22)/b20-12+ |
| InChIKey | UULYEFJYIWXKDQ-UDWIEESQSA-N |
| XLogP | 0.72 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|