C19H16N6O3 — CID 172978386
(1Z)-2-amino-N-[4-(1-benzofuran-2-carbonylamino)-3-methoxyanilino]-2-iminoethanimidoyl cyanide (PubChem CID 172978386) has the molecular formula C19H16N6O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-(1-benzofuran-2-carbonylamino)-3-methoxyanilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-(1-benzofuran-2-carbonylamino)-3-methoxyanilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978386 |
| Molecular Formula | C19H16N6O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (1Z)-2-amino-N-[4-(1-benzofuran-2-carbonylamino)-3-methoxyanilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(NC(=O)c2cc3ccccc3o2)c(OC)c1 |
| InChI | InChI=1S/C19H16N6O3/c1-27-16-9-12(24-25-14(10-20)18(21)22)6-7-13(16)23-19(26)17-8-11-4-2-3-5-15(11)28-17/h2-9,24H,1H3,(H3,21,22)(H,23,26)/b25-14+ |
| InChIKey | JZHYNLOBANGIDC-AFUMVMLFSA-N |
| XLogP | 2.92 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|