C31H25NO5Se — CID 172994725
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(9H-xanthen-9-ylselanyl)propanoic acid (PubChem CID 172994725) has the molecular formula C31H25NO5Se and a molecular weight of 570.50 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(9H-xanthen-9-ylselanyl)propanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(9H-xanthen-9-ylselanyl)propanoic acid |
|---|---|
| PubChem CID | 172994725 |
| Molecular Formula | C31H25NO5Se |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(9H-xanthen-9-ylselanyl)propanoic acid |
| SMILES | O=C(N[C@H](C[Se]C1c2ccccc2Oc2ccccc21)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H25NO5Se/c33-30(34)26(18-38-29-23-13-5-7-15-27(23)37-28-16-8-6-14-24(28)29)32-31(35)36-17-25-21-11-3-1-9-19(21)20-10-2-4-12-22(20)25/h1-16,25-26,29H,17-18H2,(H,32,35)(H,33,34)/t26-/m1/s1 |
| InChIKey | PDQWNIOBRRROLD-AREMUKBSSA-N |
| XLogP | 6.00 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|