C18H40N4Si — CID 173001994
2-N,2-N',3-N-tri(propan-2-yl)-1-silyl-3,4,4a,5,6,7,8,8a-octahydroquinoline-2,2,3-triamine (PubChem CID 173001994) has the molecular formula C18H40N4Si and a molecular weight of 340.63 g/mol. Its IUPAC name is 2-N,2-N',3-N-tri(propan-2-yl)-1-silyl-3,4,4a,5,6,7,8,8a-octahydroquinoline-2,2,3-triamine.
| Compound Name | 2-N,2-N',3-N-tri(propan-2-yl)-1-silyl-3,4,4a,5,6,7,8,8a-octahydroquinoline-2,2,3-triamine |
|---|---|
| PubChem CID | 173001994 |
| Molecular Formula | C18H40N4Si |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 2-N,2-N',3-N-tri(propan-2-yl)-1-silyl-3,4,4a,5,6,7,8,8a-octahydroquinoline-2,2,3-triamine |
| SMILES | CC(C)NC1CC2CCCCC2N([SiH3])C1(NC(C)C)NC(C)C |
| InChI | InChI=1S/C18H40N4Si/c1-12(2)19-17-11-15-9-7-8-10-16(15)22(23)18(17,20-13(3)4)21-14(5)6/h12-17,19-21H,7-11H2,1-6,23H3 |
| InChIKey | YVVBKGNVJQJOGE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|