C12H29N3Si — CID 173002195
1-N,1-N',2-N-triethyl-2-silylcyclohexane-1,1,2-triamine (PubChem CID 173002195) has the molecular formula C12H29N3Si and a molecular weight of 243.47 g/mol. Its IUPAC name is 1-N,1-N',2-N-triethyl-2-silylcyclohexane-1,1,2-triamine.
| Compound Name | 1-N,1-N',2-N-triethyl-2-silylcyclohexane-1,1,2-triamine |
|---|---|
| PubChem CID | 173002195 |
| Molecular Formula | C12H29N3Si |
| Molecular Weight | 243.47 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | 1-N,1-N',2-N-triethyl-2-silylcyclohexane-1,1,2-triamine |
| SMILES | CCNC1([SiH3])CCCCC1(NCC)NCC |
| InChI | InChI=1S/C12H29N3Si/c1-4-13-11(14-5-2)9-7-8-10-12(11,16)15-6-3/h13-15H,4-10H2,1-3,16H3 |
| InChIKey | YSRDZHYXOQWCGY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|