C12H21N3O6 — CID 173007879
2-[(2S)-6-amino-2-(3-aminopropanoylamino)hexanoyl]propanedioic acid (PubChem CID 173007879) has the molecular formula C12H21N3O6 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[(2S)-6-amino-2-(3-aminopropanoylamino)hexanoyl]propanedioic acid.
| Compound Name | 2-[(2S)-6-amino-2-(3-aminopropanoylamino)hexanoyl]propanedioic acid |
|---|---|
| PubChem CID | 173007879 |
| Molecular Formula | C12H21N3O6 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[(2S)-6-amino-2-(3-aminopropanoylamino)hexanoyl]propanedioic acid |
| SMILES | NCCCC[C@H](NC(=O)CCN)C(=O)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21N3O6/c13-5-2-1-3-7(15-8(16)4-6-14)10(17)9(11(18)19)12(20)21/h7,9H,1-6,13-14H2,(H,15,16)(H,18,19)(H,20,21)/t7-/m0/s1 |
| InChIKey | ITJLYVWUTYUIGI-ZETCQYMHSA-N |
| XLogP | -1.70 |
| TPSA | 172.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|