C12H24N4O4 — CID 141423979
(4S)-8-amino-4-[(2-aminoacetyl)amino]-2-(2-aminoethyl)-3-oxooctanoic acid (PubChem CID 141423979) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is (4S)-8-amino-4-[(2-aminoacetyl)amino]-2-(2-aminoethyl)-3-oxooctanoic acid.
| Compound Name | (4S)-8-amino-4-[(2-aminoacetyl)amino]-2-(2-aminoethyl)-3-oxooctanoic acid |
|---|---|
| PubChem CID | 141423979 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (4S)-8-amino-4-[(2-aminoacetyl)amino]-2-(2-aminoethyl)-3-oxooctanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CN)C(=O)C(CCN)C(=O)O |
| InChI | InChI=1S/C12H24N4O4/c13-5-2-1-3-9(16-10(17)7-15)11(18)8(4-6-14)12(19)20/h8-9H,1-7,13-15H2,(H,16,17)(H,19,20)/t8?,9-/m0/s1 |
| InChIKey | YPFJSQHTWQJPOA-GKAPJAKFSA-N |
| XLogP | -1.82 |
| TPSA | 161.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|