About zinc oxido nitrate
zinc oxido nitrate (PubChem CID 173013987) has the molecular formula N2O8Zn
and a molecular weight of 221.40 g/mol. Its IUPAC name is zinc oxido nitrate.
Molecular Properties
| Compound Name | zinc oxido nitrate |
| PubChem CID | 173013987 |
| Molecular Formula | N2O8Zn |
| Molecular Weight | 221.40 g/mol |
| Exact Mass | 219.89 |
| IUPAC Name | zinc oxido nitrate |
| SMILES | O=[N+]([O-])O[O-].O=[N+]([O-])O[O-].[Zn+2] |
| InChI | InChI=1S/2HNO4.Zn/c2*2-1(3)5-4;/h2*4H;/q;;+2/p-2 |
| InChIKey | FYIIJQHSTOQRMT-UHFFFAOYSA-L |
| XLogP | -3.06 |
| TPSA | 150.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.40 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze zinc oxido nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc oxido nitrate?
The IUPAC name of zinc oxido nitrate (CID 173013987) is zinc oxido nitrate.
What is the SMILES notation for zinc oxido nitrate?
The canonical SMILES for zinc oxido nitrate is O=[N+]([O-])O[O-].O=[N+]([O-])O[O-].[Zn+2].
What is the InChIKey of zinc oxido nitrate?
The InChIKey is FYIIJQHSTOQRMT-UHFFFAOYSA-L. The full InChI is InChI=1S/2HNO4.Zn/c2*2-1(3)5-4;/h2*4H;/q;;+2/p-2.
What are the key properties of zinc oxido nitrate?
zinc oxido nitrate has a molecular weight of 221.40 g/mol, XLogP of -3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zinc oxido nitrate is sourced from PubChem (CID 173013987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).