C20H46O4Si2 — CID 173016836
1,1-di(propan-2-yloxy)ethyl-[4-[1,1-di(propan-2-yloxy)ethylsilyl]butyl]silane (PubChem CID 173016836) has the molecular formula C20H46O4Si2 and a molecular weight of 406.76 g/mol. Its IUPAC name is 1,1-di(propan-2-yloxy)ethyl-[4-[1,1-di(propan-2-yloxy)ethylsilyl]butyl]silane.
| Compound Name | 1,1-di(propan-2-yloxy)ethyl-[4-[1,1-di(propan-2-yloxy)ethylsilyl]butyl]silane |
|---|---|
| PubChem CID | 173016836 |
| Molecular Formula | C20H46O4Si2 |
| Molecular Weight | 406.76 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 1,1-di(propan-2-yloxy)ethyl-[4-[1,1-di(propan-2-yloxy)ethylsilyl]butyl]silane |
| SMILES | CC(C)OC(C)(OC(C)C)[SiH2]CCCC[SiH2]C(C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C20H46O4Si2/c1-15(2)21-19(9,22-16(3)4)25-13-11-12-14-26-20(10,23-17(5)6)24-18(7)8/h15-18H,11-14,25-26H2,1-10H3 |
| InChIKey | YCFCIDMEPHECEC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|