C14H32N2OSi — CID 173016958
1-N,1-N,1-N',1-N'-tetraethyl-1-(3-silylbut-3-en-2-yloxy)ethane-1,1-diamine (PubChem CID 173016958) has the molecular formula C14H32N2OSi and a molecular weight of 272.51 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetraethyl-1-(3-silylbut-3-en-2-yloxy)ethane-1,1-diamine.
| Compound Name | 1-N,1-N,1-N',1-N'-tetraethyl-1-(3-silylbut-3-en-2-yloxy)ethane-1,1-diamine |
|---|---|
| PubChem CID | 173016958 |
| Molecular Formula | C14H32N2OSi |
| Molecular Weight | 272.51 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetraethyl-1-(3-silylbut-3-en-2-yloxy)ethane-1,1-diamine |
| SMILES | C=C([SiH3])C(C)OC(C)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C14H32N2OSi/c1-8-15(9-2)14(7,16(10-3)11-4)17-12(5)13(6)18/h12H,6,8-11H2,1-5,7,18H3 |
| InChIKey | OWBPJLZAJZACKV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|