C9H22N2Si — CID 173017072
3-N,3-N,3-N',3-N'-tetramethyl-2-silylpent-1-ene-3,3-diamine (PubChem CID 173017072) has the molecular formula C9H22N2Si and a molecular weight of 186.37 g/mol. Its IUPAC name is 3-N,3-N,3-N',3-N'-tetramethyl-2-silylpent-1-ene-3,3-diamine.
| Compound Name | 3-N,3-N,3-N',3-N'-tetramethyl-2-silylpent-1-ene-3,3-diamine |
|---|---|
| PubChem CID | 173017072 |
| Molecular Formula | C9H22N2Si |
| Molecular Weight | 186.37 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 3-N,3-N,3-N',3-N'-tetramethyl-2-silylpent-1-ene-3,3-diamine |
| SMILES | C=C([SiH3])C(CC)(N(C)C)N(C)C |
| InChI | InChI=1S/C9H22N2Si/c1-7-9(8(2)12,10(3)4)11(5)6/h2,7H2,1,3-6,12H3 |
| InChIKey | OADGVPAEQVCPFX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|