C19H42N2Si — CID 173017197
3-N,3-N'-dibutyl-3-N,3-N'-dipropyl-2-silylpent-1-ene-3,3-diamine (PubChem CID 173017197) has the molecular formula C19H42N2Si and a molecular weight of 326.65 g/mol. Its IUPAC name is 3-N,3-N'-dibutyl-3-N,3-N'-dipropyl-2-silylpent-1-ene-3,3-diamine.
| Compound Name | 3-N,3-N'-dibutyl-3-N,3-N'-dipropyl-2-silylpent-1-ene-3,3-diamine |
|---|---|
| PubChem CID | 173017197 |
| Molecular Formula | C19H42N2Si |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 326.31 |
| IUPAC Name | 3-N,3-N'-dibutyl-3-N,3-N'-dipropyl-2-silylpent-1-ene-3,3-diamine |
| SMILES | C=C([SiH3])C(CC)(N(CCC)CCCC)N(CCC)CCCC |
| InChI | InChI=1S/C19H42N2Si/c1-7-12-16-20(14-9-3)19(11-5,18(6)22)21(15-10-4)17-13-8-2/h6-17H2,1-5,22H3 |
| InChIKey | LVGYBQWBSZIFAM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|