C22H38N4O4 — CID 173024496
phthalic acid;bis(1,2,3,4-tetramethylimidazolidine) (PubChem CID 173024496) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is phthalic acid;bis(1,2,3,4-tetramethylimidazolidine).
| Compound Name | phthalic acid;bis(1,2,3,4-tetramethylimidazolidine) |
|---|---|
| PubChem CID | 173024496 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | phthalic acid;bis(1,2,3,4-tetramethylimidazolidine) |
| SMILES | CC1CN(C)C(C)N1C.CC1CN(C)C(C)N1C.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.2C7H16N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-6-5-8(3)7(2)9(6)4/h1-4H,(H,9,10)(H,11,12);2*6-7H,5H2,1-4H3 |
| InChIKey | PBOROENWALOVKZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |