C27H30ClN5O2S2 — CID 17302768
2-[[5-[3-(4-chloro-2-methylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 17302768) has the molecular formula C27H30ClN5O2S2 and a molecular weight of 556.16 g/mol. Its IUPAC name is 2-[[5-[3-(4-chloro-2-methylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[5-[3-(4-chloro-2-methylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 17302768 |
| Molecular Formula | C27H30ClN5O2S2 |
| Molecular Weight | 556.16 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 2-[[5-[3-(4-chloro-2-methylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | C=CCn1c(CCCOc2ccc(Cl)cc2C)nnc1SCC(=O)Nc1sc2c(c1C#N)CCC(C)C2 |
| InChI | InChI=1S/C27H30ClN5O2S2/c1-4-11-33-24(6-5-12-35-22-10-8-19(28)14-18(22)3)31-32-27(33)36-16-25(34)30-26-21(15-29)20-9-7-17(2)13-23(20)37-26/h4,8,10,14,17H,1,5-7,9,11-13,16H2,2-3H3,(H,30,34) |
| InChIKey | UXRDPNDZVKNAHR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.16 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|