C8H16B3F17S-2 — CID 173032938
1,1,1,2,2-pentafluoroethane;triethylsulfanium;tritetrafluoroborate (PubChem CID 173032938) has the molecular formula C8H16B3F17S-2 and a molecular weight of 499.69 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoroethane;triethylsulfanium;tritetrafluoroborate.
| Compound Name | 1,1,1,2,2-pentafluoroethane;triethylsulfanium;tritetrafluoroborate |
|---|---|
| PubChem CID | 173032938 |
| Molecular Formula | C8H16B3F17S-2 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 1,1,1,2,2-pentafluoroethane;triethylsulfanium;tritetrafluoroborate |
| SMILES | CC[S+](CC)CC.FC(F)C(F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C6H15S.C2HF5.3BF4/c1-4-7(5-2)6-3;3-1(4)2(5,6)7;3*2-1(3,4)5/h4-6H2,1-3H3;1H;;;/q+1;;3*-1 |
| InChIKey | OAEVAWYJCFHVAC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|